EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O5 |
| Net Charge | 0 |
| Average Mass | 376.493 |
| Monoisotopic Mass | 376.22497 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])[C@@H](O)C[C@]1(C)[C@@H](C(O)CC(=O)O)CC[C@@]21[H] |
| InChI | InChI=1S/C22H32O5/c1-21-8-7-13(23)9-12(21)3-4-14-15-5-6-16(17(24)10-19(26)27)22(15,2)11-18(25)20(14)21/h9,14-18,20,24-25H,3-8,10-11H2,1-2H3,(H,26,27)/t14-,15-,16+,17?,18-,20+,21-,22-/m0/s1 |
| InChIKey | MSUMOHDXPKCNSB-CUOJZFFHSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11beta-Hydroxy-3,20-dioxopregn-4-en-21-oic acid (CHEBI:166772) has role androgen (CHEBI:50113) |
| 11beta-Hydroxy-3,20-dioxopregn-4-en-21-oic acid (CHEBI:166772) is a 3-hydroxy steroid (CHEBI:36834) |
| IUPAC Name |
|---|
| 3-hydroxy-3-[(8S,9S,10R,11S,13S,14S,17S)-11-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 48063653 | ChemSpider |