EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30O3 |
| Net Charge | 0 |
| Average Mass | 306.446 |
| Monoisotopic Mass | 306.21949 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@H](O)[C@@H](O)C[C@@]21[H] |
| InChI | InChI=1S/C19H30O3/c1-18-7-5-12(20)9-11(18)3-4-13-14(18)6-8-19(2)15(13)10-16(21)17(19)22/h3,12-17,20-22H,4-10H2,1-2H3/t12-,13+,14-,15-,16-,17+,18-,19-/m0/s1 |
| InChIKey | GUGSXATYPSGVAY-CUZKMJQKSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-Androstene-3beta,16beta,17alpha-triol (CHEBI:166769) has role androgen (CHEBI:50113) |
| 5-Androstene-3beta,16beta,17alpha-triol (CHEBI:166769) is a 3-hydroxy steroid (CHEBI:36834) |
| IUPAC Name |
|---|
| (3S,8R,9S,10R,13S,14S,16S,17S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,16,17-triol |
| Manual Xrefs | Databases |
|---|---|
| 13628101 | ChemSpider |
| HMDB0000523 | HMDB |
| LMST02020098 | LIPID MAPS |