EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27ClO2 |
| Net Charge | 0 |
| Average Mass | 334.887 |
| Monoisotopic Mass | 334.16996 |
| SMILES | [H][C@@]12CCC3=C(Cl)C(=O)C=C[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1(C)O |
| InChI | InChI=1S/C20H27ClO2/c1-18-9-8-16(22)17(21)15(18)5-4-12-13(18)6-10-19(2)14(12)7-11-20(19,3)23/h8-9,12-14,23H,4-7,10-11H2,1-3H3/t12-,13+,14+,18-,19+,20+/m1/s1 |
| InChIKey | AGUNEISBPXQOPA-XMUHMHRVSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-Chloromethandienone (CHEBI:166768) has role androgen (CHEBI:50113) |
| 4-Chloromethandienone (CHEBI:166768) is a 3-hydroxy steroid (CHEBI:36834) |
| IUPAC Name |
|---|
| (8R,9S,10R,13S,14S,17S)-4-chloro-17-hydroxy-10,13,17-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| Manual Xrefs | Databases |
|---|---|
| 88972 | ChemSpider |
| HMDB0004634 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:2446-23-3 | ChemIDplus |