EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H48O2 |
| Net Charge | 0 |
| Average Mass | 428.701 |
| Monoisotopic Mass | 428.36543 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCCC(O)(CC)CC)[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O)CCC1=C |
| InChI | InChI=1S/C29H48O2/c1-6-29(31,7-2)19-8-10-22(4)26-16-17-27-23(11-9-18-28(26,27)5)13-14-24-20-25(30)15-12-21(24)3/h13-14,22,25-27,30-31H,3,6-12,15-20H2,1-2,4-5H3/b23-13+,24-14-/t22-,25+,26-,27+,28-/m1/s1 |
| InChIKey | BEYPISLTPLVAJI-YELRADRNSA-N |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 25-Hydroxy-26,27-dimethylvitamin D3 (CHEBI:166751) is a vitamin D (CHEBI:27300) |
| IUPAC Name |
|---|
| (1S,3Z)-3-[(2E)-2-[(1R,3aS,7aR)-1-[(2R)-6-ethyl-6-hydroxyoctan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
| Manual Xrefs | Databases |
|---|---|
| 4952701 | ChemSpider |
| LMST03020416 | LIPID MAPS |