EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32O5 |
| Net Charge | 0 |
| Average Mass | 400.515 |
| Monoisotopic Mass | 400.22497 |
| SMILES | [H][C@]12CC(=O)[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCC(=O)O)[C@]1([H])[C@H](O)CC1=CC(=O)C=C[C@@]12C |
| InChI | InChI=1S/C24H32O5/c1-13(4-7-21(28)29)16-5-6-17-22-18(12-20(27)24(16,17)3)23(2)9-8-15(25)10-14(23)11-19(22)26/h8-10,13,16-19,22,26H,4-7,11-12H2,1-3H3,(H,28,29)/t13-,16-,17+,18+,19-,22+,23+,24-/m1/s1 |
| InChIKey | QTUNPULUQOEUGW-DCKHNJRBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7alpha-Hydroxy-3,12-dioxochola-1,4-dien-24-oic acid (CHEBI:166723) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (4R)-4-[(7R,8R,9S,10R,13R,14S,17R)-7-hydroxy-10,13-dimethyl-3,12-dioxo-7,8,9,11,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMST04010391 | LIPID MAPS |
| 4447223 | ChemSpider |