EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11N3O |
| Net Charge | 0 |
| Average Mass | 129.163 |
| Monoisotopic Mass | 129.09021 |
| SMILES | [H]C(=O)CCCNC(=N)N |
| InChI | InChI=1S/C5H11N3O/c6-5(7)8-3-1-2-4-9/h4H,1-3H2,(H4,6,7,8) |
| InChIKey | VCOFTLCIPLEZKE-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-guanidinobutanal (CHEBI:16671) is a butanals (CHEBI:22939) |
| 4-guanidinobutanal (CHEBI:16671) is conjugate base of 4-guanidiniumylbutanal (CHEBI:57854) |
| Incoming Relation(s) |
| 4-guanidiniumylbutanal (CHEBI:57854) is conjugate acid of 4-guanidinobutanal (CHEBI:16671) |
| IUPAC Name |
|---|
| 1-(4-oxobutyl)guanidine |
| Synonyms | Source |
|---|---|
| 4-Guanidinobutanal | KEGG COMPOUND |
| N-(4-oxobutyl)guanidine | IUPAC |