EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H40O2 |
| Net Charge | 0 |
| Average Mass | 396.615 |
| Monoisotopic Mass | 396.30283 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCC1(C)CCc2cc(O)cc(C)c2O1 |
| InChI | InChI=1S/C27H40O2/c1-20(2)10-7-11-21(3)12-8-13-22(4)14-9-16-27(6)17-15-24-19-25(28)18-23(5)26(24)29-27/h10,12,14,18-19,28H,7-9,11,13,15-17H2,1-6H3/b21-12+,22-14+ |
| InChIKey | ODADKLYLWWCHNB-QRCIITMISA-N |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| d-Tocotrienol (CHEBI:166698) is a tocotrienol (CHEBI:33235) |
| IUPAC Name |
|---|
| 2,8-dimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-ol |
| Manual Xrefs | Databases |
|---|---|
| 5256774 | ChemSpider |
| HMDB0030008 | HMDB |