EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H7NO |
| Net Charge | 0 |
| Average Mass | 133.150 |
| Monoisotopic Mass | 133.05276 |
| SMILES | N#CCc1ccc(O)cc1 |
| InChI | InChI=1S/C8H7NO/c9-6-5-7-1-3-8(10)4-2-7/h1-4,10H,5H2 |
| InChIKey | AYKYOOPFBCOXSL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4-hydroxyphenyl)acetonitrile (CHEBI:16667) has role plant metabolite (CHEBI:76924) |
| (4-hydroxyphenyl)acetonitrile (CHEBI:16667) is a hydroxynitrile (CHEBI:24730) |
| IUPAC Name |
|---|
| (4-hydroxyphenyl)acetonitrile |
| Synonyms | Source |
|---|---|
| 4-Hydroxybenzeneacetonitrile | ChemIDplus |
| 4-Hydroxybenzyl cyanide | KEGG COMPOUND |
| 4-Hydroxybenzylcyanide | ChemIDplus |
| 4-hydroxyphenylacetic acid nitrile | NIST Chemistry WebBook |
| 4-Hydroxyphenylacetonitrile | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 4-hydroxyphenylacetonitrile | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00029532 | KNApSAcK |
| C03766 | KEGG COMPOUND |
| C03766 | KEGG COMPOUND |
| CPD-1074 | MetaCyc |
| HMDB0029757 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1934470 | Reaxys |
| CAS:14191-95-8 | KEGG COMPOUND |
| CAS:14191-95-8 | ChemIDplus |
| CAS:14191-95-8 | NIST Chemistry WebBook |
| Citations |
|---|