EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14O4 |
| Net Charge | 0 |
| Average Mass | 210.229 |
| Monoisotopic Mass | 210.08921 |
| SMILES | COc1ccc(OC)c(CCC(=O)O)c1 |
| InChI | InChI=1S/C11H14O4/c1-14-9-4-5-10(15-2)8(7-9)3-6-11(12)13/h4-5,7H,3,6H2,1-2H3,(H,12,13) |
| InChIKey | JENQUCZZZGYHRW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudognaphalium affine (ncbitaxon:318063) | - | PubMed (27324043) | Species also known as Gnaphalium affine. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(2,5-dimethoxyphenyl)propanoic acid (CHEBI:166656) has functional parent 3-phenylpropionic acid (CHEBI:28631) |
| 3-(2,5-dimethoxyphenyl)propanoic acid (CHEBI:166656) has role plant metabolite (CHEBI:76924) |
| 3-(2,5-dimethoxyphenyl)propanoic acid (CHEBI:166656) is a dimethoxybenzene (CHEBI:51681) |
| 3-(2,5-dimethoxyphenyl)propanoic acid (CHEBI:166656) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 3-(2,5-dimethoxyphenyl)propanoic acid |
| Synonyms | Source |
|---|---|
| 2,5-dimethoxybenzenepropanoic acid | ChemIDplus |
| 2,5-dimethoxydihydrocinnamic acid | ChEBI |
| 2,5-dimethoxyhydrocinnamic acid | ChemIDplus |
| 3-(2,5-dimethoxy-phenyl)-propionic acid | ChEBI |
| 3-(2,5-dimethoxyphenyl)propionic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 59721 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:10538-49-5 | NIST Chemistry WebBook |
| CAS:10538-49-5 | ChemIDplus |
| Citations |
|---|