EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16O3 |
| Net Charge | 0 |
| Average Mass | 220.268 |
| Monoisotopic Mass | 220.10994 |
| SMILES | COc1cccc(/C=C/C(=O)O)c1C(C)C |
| InChI | InChI=1S/C13H16O3/c1-9(2)13-10(7-8-12(14)15)5-4-6-11(13)16-3/h4-9H,1-3H3,(H,14,15)/b8-7+ |
| InChIKey | QWXXXRFASGFHKU-BQYQJAHWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Isopropyl-3-methoxycinnamic acid (CHEBI:166653) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (E)-3-(3-methoxy-2-propan-2-ylphenyl)prop-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4714470 | ChemSpider |