EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12O4 |
| Net Charge | 0 |
| Average Mass | 208.213 |
| Monoisotopic Mass | 208.07356 |
| SMILES | COc1ccc(OC)c(/C=C/C(=O)O)c1 |
| InChI | InChI=1S/C11H12O4/c1-14-9-4-5-10(15-2)8(7-9)3-6-11(12)13/h3-7H,1-2H3,(H,12,13)/b6-3+ |
| InChIKey | JPQWWJZORKTMIZ-ZZXKWVIFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5-Dimethoxycinnamic acid (CHEBI:166652) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (E)-3-(2,5-dimethoxyphenyl)prop-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 607778 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:10538-51-9 | ChemIDplus |