EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C6H10)n.C5H12O7P2 |
| Net Charge | 0 |
| Average Mass | 328.238 |
| Monoisotopic Mass | 328.08408 |
| SMILES | CC(C)=CCC/C(C)=C(/C)COP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C11H22O7P2/c1-9(2)6-5-7-10(3)11(4)8-17-20(15,16)18-19(12,13)14/h6H,5,7-8H2,1-4H3,(H,15,16)(H2,12,13,14)/b11-10- |
| InChIKey | PRUWPPRJQIGKNB-KHPPLWFESA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| poly-cis-polyprenyl diphosphate (CHEBI:16663) is a polyprenyl diphosphate (CHEBI:37531) |
| poly-cis-polyprenyl diphosphate (CHEBI:16663) is conjugate acid of all-cis-polyprenyl diphosphate(3−) (CHEBI:83374) |
| Incoming Relation(s) |
| all-cis-polyprenyl diphosphate(3−) (CHEBI:83374) is conjugate base of poly-cis-polyprenyl diphosphate (CHEBI:16663) |
| Synonym | Source |
|---|---|
| poly-cis-polyprenyl diphosphates | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C04093 | KEGG COMPOUND |