EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14O5 |
| Net Charge | 0 |
| Average Mass | 238.239 |
| Monoisotopic Mass | 238.08412 |
| SMILES | COc1ccc(/C=C/C(=O)O)c(OC)c1OC |
| InChI | InChI=1S/C12H14O5/c1-15-9-6-4-8(5-7-10(13)14)11(16-2)12(9)17-3/h4-7H,1-3H3,(H,13,14)/b7-5+ |
| InChIKey | ZYOPDNLIHHFGEC-FNORWQNLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trans-2, 3, 4-Trimethoxycinnamate (CHEBI:166597) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 642995 | ChemSpider |
| HMDB0011721 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:33130-03-9 | ChemIDplus |