EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:166543 - Ethyl 3-indoleacetate
| Formula | C12H13NO2 |
| Net Charge | 0 |
| Average Mass | 203.241 |
| Monoisotopic Mass | 203.09463 |
| SMILES | CCOC(=O)Cc1cnc2ccccc12 |
| InChI | InChI=1S/C12H13NO2/c1-2-15-12(14)7-9-8-13-11-6-4-3-5-10(9)11/h3-6,8,13H,2,7H2,1H3 |
| InChIKey | HUDBDWIQSIGUDI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ethyl 3-indoleacetate (CHEBI:166543) is a indole-3-acetic acids (CHEBI:24803) |
| IUPAC Name |
|---|
| ethyl 2-(1H-indol-3-yl)acetate |