EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O2 |
| Net Charge | 0 |
| Average Mass | 150.177 |
| Monoisotopic Mass | 150.06808 |
| SMILES | CC(=O)c1ccc(O)c(C)c1 |
| InChI | InChI=1S/C9H10O2/c1-6-5-8(7(2)10)3-4-9(6)11/h3-5,11H,1-2H3 |
| InChIKey | LXBHHIZIQVZGFN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gerbera piloselloides (ncbitaxon:41622) | - | PubMed (24380282) | |
| Rhus potaninii (ncbitaxon:298664) | - | PubMed (32731414) |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. insect attractant A chemical that attracts insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-3-methylacetophenone (CHEBI:166495) has functional parent acetophenone (CHEBI:27632) |
| 4-hydroxy-3-methylacetophenone (CHEBI:166495) has role insect attractant (CHEBI:24850) |
| 4-hydroxy-3-methylacetophenone (CHEBI:166495) has role volatile oil component (CHEBI:27311) |
| 4-hydroxy-3-methylacetophenone (CHEBI:166495) is a hydroxytoluene (CHEBI:24751) |
| 4-hydroxy-3-methylacetophenone (CHEBI:166495) is a monohydroxyacetophenone (CHEBI:25387) |
| 4-hydroxy-3-methylacetophenone (CHEBI:166495) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 1-(4-hydroxy-3-methylphenyl)ethanone |
| Synonyms | Source |
|---|---|
| 1-(3-methyl-4-hydroxyphenyl)ethanone | ChEBI |
| 1-(4-hydroxy-3-methylphenyl)ethan-1-one | IUPAC |
| 1-(4-hydroxy-3-methyl-phenyl)ethanone | PDBeChem |
| 2-methyl-4-acetylphenol | ChEBI |
| 3'-methyl-4'-hydroxyacetophenone | ChEBI |
| 4-acetyl-2-methylphenol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 63323 | ChemSpider |
| HMDB0059824 | HMDB |
| YTP | PDBeChem |
| Citations |
|---|