EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O3 |
| Net Charge | 0 |
| Average Mass | 116.116 |
| Monoisotopic Mass | 116.04734 |
| SMILES | COC(=O)CC(C)=O |
| InChI | InChI=1S/C5H8O3/c1-4(6)3-5(7)8-2/h3H2,1-2H3 |
| InChIKey | WRQNANDWMGAFTP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methylacetoacetic acid (CHEBI:166454) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| methyl 3-oxobutanoate |
| Manual Xrefs | Databases |
|---|---|
| 13874867 | ChemSpider |
| C02233 | KEGG COMPOUND |
| HMDB0000310 | HMDB |
| LMFA01060005 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:105-45-3 | ChemIDplus |