EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11N2O2 |
| Net Charge | -1 |
| Average Mass | 131.155 |
| Monoisotopic Mass | 131.08260 |
| SMILES | CC(N)CC(N)C(=O)[O-] |
| InChI | InChI=1S/C5H12N2O2/c1-3(6)2-4(7)5(8)9/h3-4H,2,6-7H2,1H3,(H,8,9)/p-1 |
| InChIKey | PCEJMSIIDXUDSN-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-diaminopentanoate (CHEBI:16594) has functional parent valerate (CHEBI:31011) |
| 2,4-diaminopentanoate (CHEBI:16594) is a α-amino-acid anion (CHEBI:33558) |
| 2,4-diaminopentanoate (CHEBI:16594) is conjugate base of 2,4-diaminopentanoic acid (CHEBI:904) |
| Incoming Relation(s) |
| (2R,4S)-2,4-diaminopentanoate (CHEBI:15601) is a 2,4-diaminopentanoate (CHEBI:16594) |
| 2,4-diaminopentanoic acid (CHEBI:904) is conjugate acid of 2,4-diaminopentanoate (CHEBI:16594) |
| IUPAC Name |
|---|
| 2,4-diaminopentanoate |