EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8Cl3NO3S |
| Net Charge | 0 |
| Average Mass | 292.571 |
| Monoisotopic Mass | 290.92905 |
| SMILES | CC(=O)N[C@@H](CSC(Cl)=C(Cl)Cl)C(=O)O |
| InChI | InChI=1S/C7H8Cl3NO3S/c1-3(12)11-4(7(13)14)2-15-6(10)5(8)9/h4H,2H2,1H3,(H,11,12)(H,13,14)/t4-/m0/s1 |
| InChIKey | NBGLMNHGJFSOCH-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-Acetyl-S-(trichlorovinyl)-cysteine (CHEBI:165889) is a N-acyl-L-amino acid (CHEBI:21644) |
| IUPAC Name |
|---|
| (2R)-2-acetamido-3-(1,2,2-trichloroethenylsulanyl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 106773 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:111348-61-9 | ChemIDplus |