EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13NO6S |
| Net Charge | 0 |
| Average Mass | 263.271 |
| Monoisotopic Mass | 263.04636 |
| SMILES | CC(=O)N[C@@H](CSCCC(=O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C9H13NO6S/c1-5(11)10-6(8(13)14)4-17-3-2-7(12)9(15)16/h6H,2-4H2,1H3,(H,10,11)(H,13,14)(H,15,16)/t6-/m0/s1 |
| InChIKey | AHFWWWFNCBRMIV-LURJTMIESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-Acetyl-S-(3-oxo-3-carboxy-n-propyl)cysteine (CHEBI:165885) is a N-acyl-L-amino acid (CHEBI:21644) |
| IUPAC Name |
|---|
| 4-[(2R)-2-acetamido-2-carboxyethyl]sulanyl-2-oxobutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 13628313 | ChemSpider |
| HMDB0002194 | HMDB |