EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9Cl2NO3S |
| Net Charge | 0 |
| Average Mass | 258.126 |
| Monoisotopic Mass | 256.96802 |
| SMILES | CC(=O)N[C@@H](CS/C(Cl)=C\Cl)C(=O)O |
| InChI | InChI=1S/C7H9Cl2NO3S/c1-4(11)10-5(7(12)13)3-14-6(9)2-8/h2,5H,3H2,1H3,(H,10,11)(H,12,13)/b6-2-/t5-/m0/s1 |
| InChIKey | LPPJGTSPIBSYQO-YLNOTJRMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-Acetyl-S-(1,2-dichlorovinyl)-cysteine (CHEBI:165874) is a N-acyl-L-amino acid (CHEBI:21644) |
| IUPAC Name |
|---|
| (2R)-2-acetamido-3-[(E)-1,2-dichloroethenyl]sulanylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 29786768 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:104713-70-4 | ChemIDplus |