EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H20N2O2 |
| Net Charge | 0 |
| Average Mass | 188.271 |
| Monoisotopic Mass | 188.15248 |
| SMILES | C[N+](C)(C)CCCC[C@H](N)C(=O)[O-] |
| InChI | InChI=1S/C9H20N2O2/c1-11(2,3)7-5-4-6-8(10)9(12)13/h8H,4-7,10H2,1-3H3/t8-/m0/s1 |
| InChIKey | MXNRLFUSFKVQSK-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-6-Trimethyllysine (CHEBI:165870) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (2S)-2-amino-6-(trimethylazaniumyl)hexanoate |
| Manual Xrefs | Databases |
|---|---|
| 389120 | ChemSpider |
| N6N6N6-TRIMETHYL-L-LYSINE | MetaCyc |
| HMDB0001325 | HMDB |
| C03793 | KEGG COMPOUND |