EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16N4O4 |
| Net Charge | 0 |
| Average Mass | 232.240 |
| Monoisotopic Mass | 232.11715 |
| SMILES | NC(N)=NCCCC(NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H16N4O4/c9-8(10)11-3-1-2-5(7(15)16)12-4-6(13)14/h5,12H,1-4H2,(H,13,14)(H,15,16)(H4,9,10,11) |
| InChIKey | LJNDQMBPIQGDNB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-Acetopine (CHEBI:165868) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-(carboxymethylamino)-5-(diaminomethylideneamino)pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0039111 | HMDB |
| 11545330 | ChemSpider |