EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14N2O3 |
| Net Charge | 0 |
| Average Mass | 246.266 |
| Monoisotopic Mass | 246.10044 |
| SMILES | O=C(O)CNC(=O)CCc1cnc2ccccc12 |
| InChI | InChI=1S/C13H14N2O3/c16-12(15-8-13(17)18)6-5-9-7-14-11-4-2-1-3-10(9)11/h1-4,7,14H,5-6,8H2,(H,15,16)(H,17,18) |
| InChIKey | WPZHLFMFBBIAFZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Indolepropionylglycine (CHEBI:165865) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 2-[3-(1H-indol-3-yl)propanoylamino]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 5990843 | ChemSpider |