EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H24N2O8 |
| Net Charge | 0 |
| Average Mass | 324.330 |
| Monoisotopic Mass | 324.15327 |
| SMILES | NCCCC[C@@H](C(=O)O)N(O)C1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H24N2O8/c13-4-2-1-3-6(12(19)20)14(21)11-10(18)9(17)8(16)7(5-15)22-11/h6-11,15-18,21H,1-5,13H2,(H,19,20)/t6-,7+,8-,9-,10+,11?/m0/s1 |
| InChIKey | RCPOVANIIKXVTB-YPPRVYOWSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Galactosylhydroxylysine (CHEBI:165859) is a glyco-amino acid (CHEBI:35258) |
| IUPAC Name |
|---|
| (2S)-6-amino-2-[hydroxy-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]hexanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 17215976 | ChemSpider |
| HMDB0000600 | HMDB |
| C05547 | KEGG COMPOUND |