EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9NO2 |
| Net Charge | 0 |
| Average Mass | 127.143 |
| Monoisotopic Mass | 127.06333 |
| SMILES | C=C1CC1C(N)C(=O)O |
| InChI | InChI=1S/C6H9NO2/c1-3-2-4(3)5(7)6(8)9/h4-5H,1-2,7H2,(H,8,9) |
| InChIKey | MPIZVHPMGFWKMJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CPD-9757 (CHEBI:165857) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-amino-2-(2-methylidenecyclopropyl)acetic acid |