EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22N2O7 |
| Net Charge | 0 |
| Average Mass | 366.370 |
| Monoisotopic Mass | 366.14270 |
| SMILES | N[C@@H](Cc1c(C2OC(CO)C(O)C(O)C2O)nc2ccccc12)C(=O)O |
| InChI | InChI=1S/C17H22N2O7/c18-9(17(24)25)5-8-7-3-1-2-4-10(7)19-12(8)16-15(23)14(22)13(21)11(6-20)26-16/h1-4,9,11,13-16,19-23H,5-6,18H2,(H,24,25)/t9-,11?,13?,14?,15?,16?/m0/s1 |
| InChIKey | CPXSBHKDEPPWIX-NJORQXHJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| C-Glycosyltryptophan (CHEBI:165856) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| (2S)-2-amino-3-[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1H-indol-3-yl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 10478214 | ChemSpider |