EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9N3O2 |
| Net Charge | 0 |
| Average Mass | 155.157 |
| Monoisotopic Mass | 155.06948 |
| SMILES | NC(Cn1cccn1)C(=O)O |
| InChI | InChI=1S/C6H9N3O2/c7-5(6(10)11)4-9-3-1-2-8-9/h1-3,5H,4,7H2,(H,10,11) |
| InChIKey | PIGOPELHGLPKLL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(1-Pyrazolyl)-alanine (CHEBI:165849) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-amino-3-pyrazol-1-ylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 106812 | ChemSpider |
| C01162 | KEGG COMPOUND |
| HMDB0034267 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:28024-60-4 | ChemIDplus |