EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9NO3 |
| Net Charge | 0 |
| Average Mass | 143.142 |
| Monoisotopic Mass | 143.05824 |
| SMILES | C/C=C/C(=O)NCC(=O)O |
| InChI | InChI=1S/C6H9NO3/c1-2-3-5(8)7-4-6(9)10/h2-3H,4H2,1H3,(H,7,8)(H,9,10)/b3-2+ |
| InChIKey | WWJXRJJBIVSSNF-NSCUHMNNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Butenoylglycine (CHEBI:165848) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 2-[[(E)-but-2-enoyl]amino]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 4877902 | ChemSpider |