EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H18 |
| Net Charge | 0 |
| Average Mass | 114.232 |
| Monoisotopic Mass | 114.14085 |
| SMILES | CC(C)C(C)C(C)C |
| InChI | InChI=1S/C8H18/c1-6(2)8(5)7(3)4/h6-8H,1-5H3 |
| InChIKey | RLPGDEORIPLBNF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bos taurus (ncbitaxon:9913) | - | DOI (10.1016/j.meatsci.2004.12.003) | Found in cooked beef. |
| Roles Classification |
|---|
| Biological Roles: | nephrotoxic agent A role played by any chemical compound (natural or synthetic) exhibiting itself through the ability to induce damage to the kidneys. mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3,4-trimethylpentane (CHEBI:165735) has role mammalian metabolite (CHEBI:75768) |
| 2,3,4-trimethylpentane (CHEBI:165735) has role nephrotoxic agent (CHEBI:50909) |
| 2,3,4-trimethylpentane (CHEBI:165735) is a alkane (CHEBI:18310) |
| 2,3,4-trimethylpentane (CHEBI:165735) is a volatile organic compound (CHEBI:134179) |
| IUPAC Name |
|---|
| 2,3,4-trimethylpentane |
| Synonyms | Source |
|---|---|
| 2,3,4-TMP | ChEBI |
| 2,3,4-trimethyl-pentane | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| 10795 | ChemSpider |
| 2,3,4-Trimethylpentane | Wikipedia |
| LMFA11000711 | LIPID MAPS |
| Citations |
|---|