EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16558 - triacetic acid
| Formula | C6H8O4 |
| Net Charge | 0 |
| Average Mass | 144.126 |
| Monoisotopic Mass | 144.04226 |
| SMILES | CC(=O)CC(=O)CC(=O)O |
| InChI | InChI=1S/C6H8O4/c1-4(7)2-5(8)3-6(9)10/h2-3H2,1H3,(H,9,10) |
| InChIKey | ILJSQTXMGCGYMG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triacetic acid (CHEBI:16558) is a dioxo monocarboxylic acid (CHEBI:35951) |
| triacetic acid (CHEBI:16558) is a β-diketone (CHEBI:67265) |
| triacetic acid (CHEBI:16558) is conjugate acid of triacetate(1−) (CHEBI:57814) |
| Incoming Relation(s) |
| triacetate(1−) (CHEBI:57814) is conjugate base of triacetic acid (CHEBI:16558) |
| IUPAC Name |
|---|
| 3,5-dioxohexanoic acid |
| Synonym | Source |
|---|---|
| Triacetate | KEGG COMPOUND |