EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H41NO3 |
| Net Charge | 0 |
| Average Mass | 355.563 |
| Monoisotopic Mass | 355.30864 |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C21H41NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20(23)22-19(2)21(24)25/h19H,3-18H2,1-2H3,(H,22,23)(H,24,25)/t19-/m0/s1 |
| InChIKey | UYZIMGIUGBXMOC-IBGZPJMESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-Stearoyl alanine (CHEBI:165563) is a N-acyl-L-amino acid (CHEBI:21644) |
| N-Stearoyl alanine (CHEBI:165563) is conjugate acid of N-stearoyl-L-alaninate (CHEBI:196965) |
| Incoming Relation(s) |
| N-stearoyl-L-alaninate (CHEBI:196965) is conjugate base of N-Stearoyl alanine (CHEBI:165563) |
| IUPAC Name |
|---|
| (2S)-2-(octadecanoylamino)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 18997987 | ChemSpider |
| LMFA08020125 | LIPID MAPS |