EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H41NO3 |
| Net Charge | 0 |
| Average Mass | 367.574 |
| Monoisotopic Mass | 367.30864 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NCCCC(=O)O |
| InChI | InChI=1S/C22H41NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18-21(24)23-20-17-19-22(25)26/h9-10H,2-8,11-20H2,1H3,(H,23,24)(H,25,26)/b10-9- |
| InChIKey | NFYDTZXYPVTQHJ-KTKRTIGZSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-Oleoyl GABA (CHEBI:165543) has functional parent γ-amino acid (CHEBI:33707) |
| N-Oleoyl GABA (CHEBI:165543) is a organonitrogen compound (CHEBI:35352) |
| N-Oleoyl GABA (CHEBI:165543) is a organooxygen compound (CHEBI:36963) |
| N-Oleoyl GABA (CHEBI:165543) is conjugate acid of N-oleoyl-γ-aminobutyrate (CHEBI:196969) |
| Incoming Relation(s) |
| N-oleoyl-γ-aminobutyrate (CHEBI:196969) is conjugate base of N-Oleoyl GABA (CHEBI:165543) |
| IUPAC Name |
|---|
| 4-[[(Z)-octadec-9-enoyl]amino]butanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 52084787 | ChemSpider |
| HMDB0062335 | HMDB |
| LMFA08020104 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:133177-46-5 | ChemIDplus |