EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H39NO3 |
| Net Charge | 0 |
| Average Mass | 353.547 |
| Monoisotopic Mass | 353.29299 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C21H39NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20(23)22-19(2)21(24)25/h10-11,19H,3-9,12-18H2,1-2H3,(H,22,23)(H,24,25)/b11-10-/t19-/m0/s1 |
| InChIKey | CHQZBIVWDKADIA-GDWUOILNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-Oleoyl alanine (CHEBI:165541) is a N-acyl-L-amino acid (CHEBI:21644) |
| N-Oleoyl alanine (CHEBI:165541) is conjugate acid of N-oleoyl-L-alaninate (CHEBI:196966) |
| Incoming Relation(s) |
| N-oleoyl-L-alaninate (CHEBI:196966) is conjugate base of N-Oleoyl alanine (CHEBI:165541) |
| IUPAC Name |
|---|
| (2S)-2-[[(Z)-octadec-9-enoyl]amino]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 23283780 | ChemSpider |
| LMFA08020124 | LIPID MAPS |