EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H13N3O8 |
| Net Charge | 0 |
| Average Mass | 423.337 |
| Monoisotopic Mass | 423.07026 |
| SMILES | NC(CC(=O)c1cccc2oc3cc(=O)c4nc(C(=O)O)cc(O)c4c-3nc12)C(=O)O |
| InChI | InChI=1S/C20H13N3O8/c21-8(19(27)28)4-10(24)7-2-1-3-13-16(7)23-18-14(31-13)6-12(26)17-15(18)11(25)5-9(22-17)20(29)30/h1-3,5-6,8H,4,21H2,(H,22,25)(H,27,28)(H,29,30) |
| InChIKey | QLAHWTNCEYYDRR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xanthommatin (CHEBI:16550) is a xanthommatins (CHEBI:27323) |
| xanthommatin (CHEBI:16550) is conjugate acid of xanthommatin(1−) (CHEBI:57808) |
| Incoming Relation(s) |
| xanthommatin(1−) (CHEBI:57808) is conjugate base of xanthommatin (CHEBI:16550) |
| IUPAC Name |
|---|
| 11-(3-amino-3-carboxypropanoyl)-1-hydroxy-5-oxo-5H-pyrido[3,2-a]phenoxazine-3-carboxylic acid |
| Synonym | Source |
|---|---|
| Xanthommatin | KEGG COMPOUND |
| Citations |
|---|