EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8ClN3O5 |
| Net Charge | 0 |
| Average Mass | 285.643 |
| Monoisotopic Mass | 285.01525 |
| SMILES | Nc1cnn(C(=O)/C=C\C=C(\O)C(=O)O)c(=O)c1Cl |
| InChI | InChI=1S/C10H8ClN3O5/c11-8-5(12)4-13-14(9(8)17)7(16)3-1-2-6(15)10(18)19/h1-4,15H,12H2,(H,18,19)/b3-1-,6-2+ |
| InChIKey | VPRVQIJXVCMMQE-JUEFVVJZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-Amino-4-Chloro-2-(5-hydroxymuconoyl)-3(2H)-pyridazinone (CHEBI:165497) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4Z)-6-(4-amino-5-chloro-6-oxopyridazin-1-yl)-2-hydroxy-6-oxohexa-2,4-dienoic acid |