EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16548 - chlordecone
| Formula | C10Cl10O |
| Net Charge | 0 |
| Average Mass | 490.639 |
| Monoisotopic Mass | 485.68344 |
| SMILES | O=C1C2(Cl)C3(Cl)C4(Cl)C(Cl)(Cl)C5(Cl)C3(Cl)C1(Cl)C5(Cl)C24Cl |
| InChI | InChI=1S/C10Cl10O/c11-2-1(21)3(12)6(15)4(2,13)8(17)5(2,14)7(3,16)9(6,18)10(8,19)20 |
| InChIKey | LHHGDZSESBACKH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | persistent organic pollutant Any environmental contaminant that is resistant to environmental degradation through photolytic, biological or chemical processes. Such substances can have significant impact on health and the environment, as they persist in the environment, bioaccumulate in animal tissue and so biomagnify in food chains. |
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlordecone (CHEBI:16548) has role insecticide (CHEBI:24852) |
| chlordecone (CHEBI:16548) has role persistent organic pollutant (CHEBI:77853) |
| chlordecone (CHEBI:16548) is a cyclic ketone (CHEBI:3992) |
| chlordecone (CHEBI:16548) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 1,1a,3,3a,4,5,5,5a,5b,6-decachlorooctahydro-2H-1,3,4-(methanetriyl)cyclobuta[cd]pentalen-2-one |
| Synonyms | Source |
|---|---|
| Chlordecone | KEGG COMPOUND |
| Kepone | KEGG COMPOUND |
| GC 1189 | ChemIDplus |
| 1,2,3,4,6,7,8,9,10,10-decachloropentacyclo[5.3.0.02,6.03,9.04,8]decan-5-one | IUPAC |
| perchloropentacyclo[5.3.0.02,6.03,9.04,8]decan-5-one | ChemIDplus |
| decachloropentacyclo[5.2.1.02,6.03,9.05,8]decan-4-one | ChemIDplus |
| UniProt Name | Source |
|---|---|
| chlordecone | UniProt |
| Citations |
|---|