EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O2 |
| Net Charge | 0 |
| Average Mass | 306.490 |
| Monoisotopic Mass | 306.25588 |
| SMILES | [H]C(CCCCCCCC)=C([H])CC([H])=C([H])CC([H])=C([H])CCCC(=O)O |
| InChI | InChI=1S/C20H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h9-10,12-13,15-16H,2-8,11,14,17-19H2,1H3,(H,21,22) |
| InChIKey | UNSRRHDPHVZAHH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,8,11-eicosatrienoic acid (CHEBI:165475) is a fatty acid 20:3 (CHEBI:36036) |
| Incoming Relation(s) |
| (5Z,8Z,11Z)-icosatrienoic acid (CHEBI:72865) is a 5,8,11-eicosatrienoic acid (CHEBI:165475) |
| IUPAC Name |
|---|
| icosa-5,8,11-trienoic acid |
| Synonyms | Source |
|---|---|
| eicosa-5,8,11-trienoic acid | ChEBI |
| Δ-5,8,11-eicosatrienoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 3888 | ChemSpider |
| LMFA01030157 | LIPID MAPS |
| HMDB0245590 | HMDB |
| FDB027529 | FooDB |
| Registry Numbers | Sources |
|---|---|
| CAS:2751-14-6 | ChemIDplus |
| Citations |
|---|