EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H17NO4 |
| Net Charge | 0 |
| Average Mass | 215.249 |
| Monoisotopic Mass | 215.11576 |
| SMILES | N[C@H](CCCCCC(=O)C1CO1)C(=O)O |
| InChI | InChI=1S/C10H17NO4/c11-7(10(13)14)4-2-1-3-5-8(12)9-6-15-9/h7,9H,1-6,11H2,(H,13,14)/t7-,9?/m1/s1 |
| InChIKey | PFDHVDFPTKSEKN-YOXFSPIKSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Amino-8-oxo-9,10-epoxy-decanoic acid (CHEBI:165431) is a D-α-amino acid (CHEBI:16733) |
| IUPAC Name |
|---|
| (2R)-2-amino-8-(oxiran-2-yl)-8-oxooctanoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01060176 | LIPID MAPS |
| 17220722 | ChemSpider |