EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20O5 |
| Net Charge | 0 |
| Average Mass | 268.309 |
| Monoisotopic Mass | 268.13107 |
| SMILES | CCCCCc1oc(CCC(=O)O)c(C(=O)O)c1C |
| InChI | InChI=1S/C14H20O5/c1-3-4-5-6-10-9(2)13(14(17)18)11(19-10)7-8-12(15)16/h3-8H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | RIJDKRLRDVBUHJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Carboxy-4-methyl-5-pentyl-2-furanpropanoic acid (CHEBI:165398) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| 2-(2-carboxyethyl)-4-methyl-5-pentyluran-3-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0061643 | HMDB |
| LMFA01150047 | LIPID MAPS |
| 168762 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:73248-95-0 | ChemIDplus |