EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14O5 |
| Net Charge | 0 |
| Average Mass | 202.206 |
| Monoisotopic Mass | 202.08412 |
| SMILES | C/C=C(\CO)C(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C9H14O5/c1-2-6(5-10)7(3-8(11)12)4-9(13)14/h2,7,10H,3-5H2,1H3,(H,11,12)(H,13,14)/b6-2+ |
| InChIKey | FUMUSIMACHNZQF-QHHAFSJGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(1-Hydroxymethyl-1-propenyl)pentanedioic acid (CHEBI:165379) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 3-[(Z)-1-hydroxybut-2-en-2-yl]pentanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| 25936984 | ChemSpider |
| HMDB0033092 | HMDB |