EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23BrO2 |
| Net Charge | 0 |
| Average Mass | 315.251 |
| Monoisotopic Mass | 314.08814 |
| SMILES | CCC/C(Br)=C/C=C/CC[C@H]1C[C@@H]1CCC(=O)O |
| InChI | InChI=1S/C15H23BrO2/c1-2-6-14(16)8-5-3-4-7-12-11-13(12)9-10-15(17)18/h3,5,8,12-13H,2,4,6-7,9-11H2,1H3,(H,17,18)/b5-3+,14-8-/t12-,13-/m0/s1 |
| InChIKey | XSRLEFWNCQOETJ-SULJWLEGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Majusculoic acid (CHEBI:165375) is a carbocyclic fatty acid (CHEBI:35744) |
| IUPAC Name |
|---|
| 3-[(1S,2S)-2-[(3E,5Z)-6-bromonona-3,5-dienyl]cyclopropyl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9776867 | ChemSpider |
| LMFA01140024 | LIPID MAPS |