EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8O2 |
| Net Charge | 0 |
| Average Mass | 124.139 |
| Monoisotopic Mass | 124.05243 |
| SMILES | Cc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C7H8O2/c1-5-2-6(8)4-7(9)3-5/h2-4,8-9H,1H3 |
| InChIKey | OIPPWFOQEKKFEE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ascomycota sp. Ind19F07 (ncbitaxon:1583058) | - | PubMed (25537370) | |
| Aspergillus sydowii (ncbitaxon:75750) | - | PubMed (21718031) | Ethyl acetate extract of culture broth, fungus isolated from a sea fan, Annella sp. Strain: PSU F154 |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| orcinol (CHEBI:16536) has role Aspergillus metabolite (CHEBI:76956) |
| orcinol (CHEBI:16536) is a 5-alkylresorcinol (CHEBI:52679) |
| orcinol (CHEBI:16536) is a dihydroxytoluene (CHEBI:64532) |
| IUPAC Name |
|---|
| 5-methylbenzene-1,3-diol |
| Synonyms | Source |
|---|---|
| 1,3-Dihydroxy-5-methylbenzene | ChemIDplus |
| 3,5-Dihydroxytoluene | KEGG COMPOUND |
| 3,5-Toluenediol | KEGG COMPOUND |
| 3-Hydroxy-5-methylphenol | NIST Chemistry WebBook |
| 5-Methyl-1,3-benzenediol | KEGG COMPOUND |
| 5-Methyl-1,3-dihydroxybenzene | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| orcinol | UniProt |
| Citations |
|---|