EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H32O6 |
| Net Charge | 0 |
| Average Mass | 344.448 |
| Monoisotopic Mass | 344.21989 |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1OC(O)C[C@H](O)[C@@H]1CCCCC(=O)O |
| InChI | InChI=1S/C18H32O6/c1-2-3-4-7-13(19)10-11-16-14(8-5-6-9-17(21)22)15(20)12-18(23)24-16/h10-11,13-16,18-20,23H,2-9,12H2,1H3,(H,21,22)/b11-10+/t13-,14-,15-,16+,18?/m0/s1 |
| InChIKey | LGWCOUWMTAQMQT-QCBHMXSDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-dinor-TXB1 (CHEBI:165348) has functional parent thromboxane B1 (CHEBI:73994) |
| 2,3-dinor-TXB1 (CHEBI:165348) has role rat metabolite (CHEBI:86264) |
| 2,3-dinor-TXB1 (CHEBI:165348) is a monocarboxylic acid (CHEBI:25384) |
| 2,3-dinor-TXB1 (CHEBI:165348) is a secondary allylic alcohol (CHEBI:134396) |
| 2,3-dinor-TXB1 (CHEBI:165348) is a thromboxanes B (CHEBI:26996) |
| IUPAC Name |
|---|
| (5R)-4-(4-carboxybutyl)-2,4-dideoxy-5-[(1E,3S)-3-hydroxyoct-1-en-1-yl]-D-erythro-pentopyranose |
| Synonyms | Source |
|---|---|
| 2,3-dinor thromboxane B1 | ChEBI |
| 9S,11,15S-trihydroxy-2,3-dinor-thrombox-13E-en-1-oic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA03030012 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:196493-76-2 | ChEBI |
| Citations |
|---|