EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24O7 |
| Net Charge | 0 |
| Average Mass | 328.361 |
| Monoisotopic Mass | 328.15220 |
| SMILES | O=C(O)CCCCC(=O)CC[C@H]1C(=O)C[C@H](O)[C@@H]1CCC(=O)O |
| InChI | InChI=1S/C16H24O7/c17-10(3-1-2-4-15(20)21)5-6-11-12(7-8-16(22)23)14(19)9-13(11)18/h11-12,14,19H,1-9H2,(H,20,21)(H,22,23)/t11-,12-,14+/m1/s1 |
| InChIKey | VNJBSPJILLFAIC-BZPMIXESSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tetranor-PGDM (CHEBI:165343) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| 8-[(1R,2R,3S)-2-(2-carboxyethyl)-3-hydroxy-5-oxocyclopentyl]-6-oxooctanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 28467789 | ChemSpider |
| LMFA03010221 | LIPID MAPS |