EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13N3O |
| Net Charge | 0 |
| Average Mass | 203.245 |
| Monoisotopic Mass | 203.10586 |
| SMILES | NC(=O)[C@@H](N)Cc1cnc2ccccc12 |
| InChI | InChI=1S/C11H13N3O/c12-9(11(13)15)5-7-6-14-10-4-2-1-3-8(7)10/h1-4,6,9,14H,5,12H2,(H2,13,15)/t9-/m0/s1 |
| InChIKey | JLSKPBDKNIXMBS-VIFPVBQESA-N |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-tryptophanamide (CHEBI:16533) has role human metabolite (CHEBI:77746) |
| L-tryptophanamide (CHEBI:16533) is a amino acid amide (CHEBI:22475) |
| L-tryptophanamide (CHEBI:16533) is a tryptophan derivative (CHEBI:27164) |
| L-tryptophanamide (CHEBI:16533) is conjugate base of L-tryptophanamide(1+) (CHEBI:57803) |
| Incoming Relation(s) |
| L-tryptophanamide(1+) (CHEBI:57803) is conjugate acid of L-tryptophanamide (CHEBI:16533) |
| L-tryptophan amide residue (CHEBI:145917) is substituent group from L-tryptophanamide (CHEBI:16533) |
| IUPAC Name |
|---|
| (2S)-2-amino-3-(1H-indol-3-yl)propanamide |
| Synonyms | Source |
|---|---|
| L-tryptophan amide | ChEBI |
| L-Tryptophanamide | KEGG COMPOUND |
| (S)-alpha-Amino-1H-indole-3-propionamide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00977 | KEGG COMPOUND |
| CPD-584 | MetaCyc |
| DB04537 | DrugBank |
| HMDB0013318 | HMDB |
| LTN | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:20696-57-5 | ChemIDplus |
| CAS:20696-57-5 | KEGG COMPOUND |
| Citations |
|---|