EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11NO4 |
| Net Charge | 0 |
| Average Mass | 209.201 |
| Monoisotopic Mass | 209.06881 |
| SMILES | O=C(O)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C10H11NO4/c12-9(13)6-11-10(14)15-7-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,11,14)(H,12,13) |
| InChIKey | CJUMAFVKTCBCJK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-benzyloxycarbonylglycine (CHEBI:16532) is a N-acylglycine (CHEBI:16180) |
| N-benzyloxycarbonylglycine (CHEBI:16532) is conjugate acid of N-benzyloxycarbonylglycinate (CHEBI:368997) |
| Incoming Relation(s) |
| N-benzyloxycarbonylglycinate (CHEBI:368997) is conjugate base of N-benzyloxycarbonylglycine (CHEBI:16532) |
| IUPAC Name |
|---|
| N-(benzyloxycarbonyl)glycine |
| Synonyms | Source |
|---|---|
| Benzyloxycarbonylglycine | ChemIDplus |
| Carbobenzoxyglycine | ChemIDplus |
| Carbobenzoxyl glycine | ChemIDplus |
| Carbobenzyloxyglycine | ChemIDplus |
| (Cbz)gly | ChemIDplus |
| N-Benzyloxycarbonylglycine | KEGG COMPOUND |