EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H36O3 |
| Net Charge | 0 |
| Average Mass | 324.505 |
| Monoisotopic Mass | 324.26645 |
| SMILES | O=C(O)CCCC/C=C\CCCCCCC/C=C\CCCCO |
| InChI | InChI=1S/C20H36O3/c21-19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20(22)23/h8-11,21H,1-7,12-19H2,(H,22,23)/b10-8-,11-9- |
| InChIKey | RYHYNNWEPYGEEH-WGEIWTTOSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20-HeDE (CHEBI:165297) is a HEDE (CHEBI:72848) |
| IUPAC Name |
|---|
| (6Z,15Z)-20-hydroxyicosa-6,15-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8601864 | ChemSpider |
| LMFA03000010 | LIPID MAPS |