EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O3 |
| Net Charge | 0 |
| Average Mass | 320.473 |
| Monoisotopic Mass | 320.23514 |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C=C\[C@H](O)CCCC(=O)O |
| InChI | InChI=1S/C20H32O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19(21)17-15-18-20(22)23/h6-7,9-10,12-14,16,19,21H,2-5,8,11,15,17-18H2,1H3,(H,22,23)/b7-6-,10-9-,13-12-,16-14+/t19-/m0/s1 |
| InChIKey | KGIJOOYOSFUGPC-CABOLEKPSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5(R)-HETE (CHEBI:165284) is a 5-HETE (CHEBI:60943) |
| 5(R)-HETE (CHEBI:165284) is enantiomer of 5(S)-HETE (CHEBI:28209) |
| Incoming Relation(s) |
| 5(S)-HETE (CHEBI:28209) is enantiomer of 5(R)-HETE (CHEBI:165284) |
| IUPAC Name |
|---|
| (5R,6E,8Z,11Z,14Z)-5-hydroxyicosa-6,8,11,14-tetraenoic acid |
| Synonyms | Source |
|---|---|
| 5R-HETE | ChEBI |
| 5R-hydroxy-6E,8Z,11Z,14Z-eicosatetraenoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| 4446289 | ChemSpider |
| LMFA03060024 | LIPID MAPS |