EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O4 |
| Net Charge | 0 |
| Average Mass | 334.456 |
| Monoisotopic Mass | 334.21441 |
| SMILES | CCC(O)/C=C/C=C\C/C=C\C=C\C(O)C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H30O4/c1-2-18(21)14-10-6-4-3-5-7-11-15-19(22)16-12-8-9-13-17-20(23)24/h4-8,10-12,14-15,18-19,21-22H,2-3,9,13,16-17H2,1H3,(H,23,24)/b6-4-,7-5-,12-8-,14-10+,15-11+ |
| InChIKey | XFYXZNAYFJZWSH-WHXLDRDUSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8,18-Di-HEPE (CHEBI:165273) is a HEPE (CHEBI:72799) |
| IUPAC Name |
|---|
| (5Z,9E,11Z,14Z,16E)-8,18-dihydroxyicosa-5,9,11,14,16-pentaenoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA03070052 | LIPID MAPS |