EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O4 |
| Net Charge | 0 |
| Average Mass | 334.456 |
| Monoisotopic Mass | 334.21441 |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C=C\[C@H](CCCC(=O)O)OO |
| InChI | InChI=1S/C20H30O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19(24-23)17-15-18-20(21)22/h3-4,6-7,9-10,12-14,16,19,23H,2,5,8,11,15,17-18H2,1H3,(H,21,22)/b4-3-,7-6-,10-9-,13-12-,16-14+/t19-/m1/s1 |
| InChIKey | NKXYOIJDQPQELO-GHWNLOBHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5S-HpEPE (CHEBI:165271) is a HPETE (CHEBI:24644) |
| 5S-HpEPE (CHEBI:165271) is conjugate acid of 5(S)-HpEPE(1−) (CHEBI:195399) |
| Incoming Relation(s) |
| 5(S)-HpEPE(1−) (CHEBI:195399) is conjugate base of 5S-HpEPE (CHEBI:165271) |
| IUPAC Name |
|---|
| (5S,6E,8Z,11Z,14Z,17Z)-5-hydroperoxyicosa-6,8,11,14,17-pentaenoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4446306 | ChemSpider |
| LMFA03070001 | LIPID MAPS |